abigailg128 abigailg128
  • 26-10-2022
  • Mathematics
contestada

-33=6b-15

pls help im failing math

Respuesta :

Otras preguntas

Which of the following is the correct structure of 2-methyl-3-heptenea. CH3-CH2-C(CH3)=CH-CH2-CH2-CH3b. CH3-CH2CH=CH-CH2CH(CH3)-CH3c. CH3-CH2-CH=CH-CH-(CH3)-CH2
Oui oui chien rouillé Vavavoo Sac re bleu jeux vidéo tic
Describe how nitrogen in proteins in dead leaves is recycled to be absorbed by plants? Please help!
find the sum of the following 2+4+6+8+.....+30​
What is the slope of the line?
What is the difference between a citizen and a representative?
HELP WILL MARK BRAINLIEST IF CORRECT Why was the defeat of Japan important to the Mongols? (4 points) The Mongols needed to conquer Japan to reach China. The Mo
What is the end of william shakespeer's play Macbeth?
PLEASE HURRY !! Which point is located at (2, -3)?
Which of the equations below have one solution? Select all that apply. 8x–3x+5=5x–2 9=3(5x–2) 6x–(3x+8)=16 9x+4–x=4(2x+1)