loganjordan12 loganjordan12
  • 21-11-2017
  • Mathematics
contestada

verify sinx-siny/cosx-cosy=-cot((x+y)/2)

Respuesta :

Rod44 Rod44
  • 21-11-2017
sin(A+B)=sinAcosB+cosAsinB
sin(A-B)=sinAcosB-cosAsinB
sin(A+B)-sin(A-B)=2cosAsinB
So, if x=A+B and y=A-B, A=(x+y)/2, B=(x-y)/2
sinx-siny=2cosAsinB=2cos((x+y)/2)sin((x-y)/2)

cos(A+B)=cosAcosB-sinAsinB
cos(A-B)=cosAcosB+sinAsinB
cos(A+B)-cos(A-B)=-2sinAsinB
cosx-cosy=-2sinAsinB=-2sin((x+y)/2)sin((x-y)/2).

So, (sinx-siny)/(cosx-cosy)=-cot((x+y)/2) QED
Answer Link

Otras preguntas

The tiny magnetic effect of atoms within a domain is due to electrons that are _____.
Describe the process of environmental protection act is created and enforced
during World War I , the congress passed the sedition act in 1918. why did many americans consider this act to be a violation of civil rights ?
write both he full balanced ionic equation for the following reaction and the balanced net ionic equation. What are the specter ions if there are any (If not wr
How do i solve 4x-5y=-19 and 3x-7y=18?
In what kind of government Does a small group have firm control over it's country?
What is the percent of increase from 60 to 75? A. 80% B. 25% C. 20% D. 15%
Area of pallalelagram base 10cm , height 7cm
Tina says that 6:8 is equivalent to 36:34.what did tina do wrong
What will happen to the charge if you remove the valence electrons??